![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Competing with IS 1.ppt | 2004-01-09 14:55 | 1.0M | |
| Competingwith IS 2.ppt | 2004-01-09 14:55 | 3.2M | |
| EC-1.ppt | 2004-01-19 10:13 | 270K | |
| EC-2.ppt | 2004-01-19 10:13 | 526K | |
| EC-3.ppt | 2004-01-19 10:13 | 314K | |
| Intro to MIS.ppt | 2004-01-09 14:56 | 864K | |
| KM-1.ppt | 2004-01-19 10:13 | 110K | |
| KM-2.ppt | 2004-01-19 10:13 | 122K | |
| KM-3.ppt | 2004-01-19 10:13 | 437K | |
| Structure of IS.ppt | 2004-01-09 14:56 | 1.1M | |
| System Design Analys..> | 2004-01-09 14:57 | 5.2M | |
| Systems Planning.ppt | 2004-01-09 14:58 | 5.5M | |
| Usability.ppt | 2004-01-09 14:55 | 605K | |